C19H13ClF3N3O3 — CID 59448737
4-[4-(3-chloro-4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 59448737) has the molecular formula C19H13ClF3N3O3 and a molecular weight of 423.78 g/mol. Its IUPAC name is 4-[4-(3-chloro-4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-(3-chloro-4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 59448737 |
| Molecular Formula | C19H13ClF3N3O3 |
| Molecular Weight | 423.78 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 4-[4-(3-chloro-4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | COc1ccc(C2(C)NC(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C2=O)cc1Cl |
| InChI | InChI=1S/C19H13ClF3N3O3/c1-18(11-4-6-15(29-2)14(20)7-11)16(27)26(17(28)25-18)12-5-3-10(9-24)13(8-12)19(21,22)23/h3-8H,1-2H3,(H,25,28) |
| InChIKey | SXFZOQNJYNWWDL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.78 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|