C14H9F3N4O2 — CID 15838444
5-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-(trifluoromethyl)benzene-1,2-dicarbonitrile (PubChem CID 15838444) has the molecular formula C14H9F3N4O2 and a molecular weight of 322.25 g/mol. Its IUPAC name is 5-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-(trifluoromethyl)benzene-1,2-dicarbonitrile.
| Compound Name | 5-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-(trifluoromethyl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 15838444 |
| Molecular Formula | C14H9F3N4O2 |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 5-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-3-(trifluoromethyl)benzene-1,2-dicarbonitrile |
| SMILES | CC1(C)NC(=O)N(c2cc(C#N)c(C#N)c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C14H9F3N4O2/c1-13(2)11(22)21(12(23)20-13)8-3-7(5-18)9(6-19)10(4-8)14(15,16)17/h3-4H,1-2H3,(H,20,23) |
| InChIKey | RHQWHRQIFDZJKM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|