C19H21N3O4 — CID 146264452
(5R)-5-ethyl-3-[6-(3-methoxy-4-methylphenoxy)-2-pyridinyl]-5-methylimidazolidine-2,4-dione (PubChem CID 146264452) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is (5R)-5-ethyl-3-[6-(3-methoxy-4-methylphenoxy)-2-pyridinyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-ethyl-3-[6-(3-methoxy-4-methylphenoxy)-2-pyridinyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146264452 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (5R)-5-ethyl-3-[6-(3-methoxy-4-methylphenoxy)-2-pyridinyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC[C@@]1(C)NC(=O)N(c2cccc(Oc3ccc(C)c(OC)c3)n2)C1=O |
| InChI | InChI=1S/C19H21N3O4/c1-5-19(3)17(23)22(18(24)21-19)15-7-6-8-16(20-15)26-13-10-9-12(2)14(11-13)25-4/h6-11H,5H2,1-4H3,(H,21,24)/t19-/m1/s1 |
| InChIKey | QVLGOWAJTXSFBZ-LJQANCHMSA-N |
| XLogP | 3.42 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|