C19H19N3O4 — CID 146264458
(5R)-3-[6-(2,3-dihydro-1-benzofuran-6-yloxy)-2-pyridinyl]-5-ethyl-5-methylimidazolidine-2,4-dione (PubChem CID 146264458) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is (5R)-3-[6-(2,3-dihydro-1-benzofuran-6-yloxy)-2-pyridinyl]-5-ethyl-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[6-(2,3-dihydro-1-benzofuran-6-yloxy)-2-pyridinyl]-5-ethyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146264458 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (5R)-3-[6-(2,3-dihydro-1-benzofuran-6-yloxy)-2-pyridinyl]-5-ethyl-5-methylimidazolidine-2,4-dione |
| SMILES | CC[C@@]1(C)NC(=O)N(c2cccc(Oc3ccc4c(c3)OCC4)n2)C1=O |
| InChI | InChI=1S/C19H19N3O4/c1-3-19(2)17(23)22(18(24)21-19)15-5-4-6-16(20-15)26-13-8-7-12-9-10-25-14(12)11-13/h4-8,11H,3,9-10H2,1-2H3,(H,21,24)/t19-/m1/s1 |
| InChIKey | LHDIPDZNDZRRAL-LJQANCHMSA-N |
| XLogP | 3.03 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|