C16H12F2N4O5 — CID 146289818
3-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]pyrimidin-4-yl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 146289818) has the molecular formula C16H12F2N4O5 and a molecular weight of 378.29 g/mol. Its IUPAC name is 3-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]pyrimidin-4-yl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]pyrimidin-4-yl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146289818 |
| Molecular Formula | C16H12F2N4O5 |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 3-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]pyrimidin-4-yl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(c2ccnc(Oc3ccc4c(c3)OC(F)(F)O4)n2)C1=O |
| InChI | InChI=1S/C16H12F2N4O5/c1-15(2)12(23)22(14(24)21-15)11-5-6-19-13(20-11)25-8-3-4-9-10(7-8)27-16(17,18)26-9/h3-7H,1-2H3,(H,21,24) |
| InChIKey | OMKMEYBQUMBYLI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|