C17H13F2N3O5 — CID 146264574
3-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]-4-pyridinyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 146264574) has the molecular formula C17H13F2N3O5 and a molecular weight of 377.30 g/mol. Its IUPAC name is 3-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]-4-pyridinyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]-4-pyridinyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146264574 |
| Molecular Formula | C17H13F2N3O5 |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 3-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]-4-pyridinyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(c2ccnc(Oc3ccc4c(c3)OC(F)(F)O4)c2)C1=O |
| InChI | InChI=1S/C17H13F2N3O5/c1-16(2)14(23)22(15(24)21-16)9-5-6-20-13(7-9)25-10-3-4-11-12(8-10)27-17(18,19)26-11/h3-8H,1-2H3,(H,21,24) |
| InChIKey | VXRDLBDJZQUWMG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|