C19H20F3N3O5 — CID 162769495
[(2R)-2-amino-1-[[6-(3-methoxy-4-methylphenoxy)-2-pyridinyl]amino]-1-oxobutan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 162769495) has the molecular formula C19H20F3N3O5 and a molecular weight of 427.38 g/mol. Its IUPAC name is [(2R)-2-amino-1-[[6-(3-methoxy-4-methylphenoxy)-2-pyridinyl]amino]-1-oxobutan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2R)-2-amino-1-[[6-(3-methoxy-4-methylphenoxy)-2-pyridinyl]amino]-1-oxobutan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 162769495 |
| Molecular Formula | C19H20F3N3O5 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | [(2R)-2-amino-1-[[6-(3-methoxy-4-methylphenoxy)-2-pyridinyl]amino]-1-oxobutan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | CC[C@@](N)(OC(=O)C(F)(F)F)C(=O)Nc1cccc(Oc2ccc(C)c(OC)c2)n1 |
| InChI | InChI=1S/C19H20F3N3O5/c1-4-18(23,30-17(27)19(20,21)22)16(26)25-14-6-5-7-15(24-14)29-12-9-8-11(2)13(10-12)28-3/h5-10H,4,23H2,1-3H3,(H,24,25,26)/t18-/m1/s1 |
| InChIKey | PIWAGFXPEAEZDH-GOSISDBHSA-N |
| XLogP | 3.30 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|