C26H18F3N3OS — CID 15952783
4-[8-oxo-5-(4-phenylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-7-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 15952783) has the molecular formula C26H18F3N3OS and a molecular weight of 477.51 g/mol. Its IUPAC name is 4-[8-oxo-5-(4-phenylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-7-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[8-oxo-5-(4-phenylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-7-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 15952783 |
| Molecular Formula | C26H18F3N3OS |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 4-[8-oxo-5-(4-phenylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-7-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)C3(CCC3)N(c3ccc(-c4ccccc4)cc3)C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C26H18F3N3OS/c27-26(28,29)22-15-21(12-9-19(22)16-30)31-23(33)25(13-4-14-25)32(24(31)34)20-10-7-18(8-11-20)17-5-2-1-3-6-17/h1-3,5-12,15H,4,13-14H2 |
| InChIKey | FFAYGZGGDJJVKI-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|