C28H24F3N5S — CID 134374755
4-[(8E)-8-(anilinomethylimino)-5-(4-methylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-7-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 134374755) has the molecular formula C28H24F3N5S and a molecular weight of 519.60 g/mol. Its IUPAC name is 4-[(8E)-8-(anilinomethylimino)-5-(4-methylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-7-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(8E)-8-(anilinomethylimino)-5-(4-methylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-7-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 134374755 |
| Molecular Formula | C28H24F3N5S |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 4-[(8E)-8-(anilinomethylimino)-5-(4-methylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-7-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | Cc1ccc(N2C(=S)N(c3ccc(C#N)c(C(F)(F)F)c3)/C(=N/CNc3ccccc3)C23CCC3)cc1 |
| InChI | InChI=1S/C28H24F3N5S/c1-19-8-11-22(12-9-19)36-26(37)35(23-13-10-20(17-32)24(16-23)28(29,30)31)25(27(36)14-5-15-27)34-18-33-21-6-3-2-4-7-21/h2-4,6-13,16,33H,5,14-15,18H2,1H3/b34-25+ |
| InChIKey | KKPQIOUAEXJKMF-YQCHCMBFSA-N |
| XLogP | 6.89 |
| TPSA | 54.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|