C28H22F3N5S2 — CID 15952885
(1E)-1-[7-[4-cyano-3-(trifluoromethyl)phenyl]-5-(4-methylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-ylidene]-3-phenylthiourea (PubChem CID 15952885) has the molecular formula C28H22F3N5S2 and a molecular weight of 549.65 g/mol. Its IUPAC name is (1E)-1-[7-[4-cyano-3-(trifluoromethyl)phenyl]-5-(4-methylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-ylidene]-3-phenylthiourea.
| Compound Name | (1E)-1-[7-[4-cyano-3-(trifluoromethyl)phenyl]-5-(4-methylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-ylidene]-3-phenylthiourea |
|---|---|
| PubChem CID | 15952885 |
| Molecular Formula | C28H22F3N5S2 |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | (1E)-1-[7-[4-cyano-3-(trifluoromethyl)phenyl]-5-(4-methylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-ylidene]-3-phenylthiourea |
| SMILES | Cc1ccc(N2C(=S)N(c3ccc(C#N)c(C(F)(F)F)c3)/C(=N/C(=S)Nc3ccccc3)C23CCC3)cc1 |
| InChI | InChI=1S/C28H22F3N5S2/c1-18-8-11-21(12-9-18)36-26(38)35(22-13-10-19(17-32)23(16-22)28(29,30)31)24(27(36)14-5-15-27)34-25(37)33-20-6-3-2-4-7-20/h2-4,6-13,16H,5,14-15H2,1H3,(H,33,37)/b34-24+ |
| InChIKey | WECDBLKWXFEYMF-JGRMKTMXSA-N |
| XLogP | 7.22 |
| TPSA | 54.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|