C32H33F3N8O2S2 — CID 160823640
tert-butyl 4-[8-[[4-cyano-3-(trifluoromethyl)phenyl]carbamothioylimino]-7-(4-isocyano-3-methylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]piperazine-1-carboxylate (PubChem CID 160823640) has the molecular formula C32H33F3N8O2S2 and a molecular weight of 682.80 g/mol. Its IUPAC name is tert-butyl 4-[8-[[4-cyano-3-(trifluoromethyl)phenyl]carbamothioylimino]-7-(4-isocyano-3-methylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[8-[[4-cyano-3-(trifluoromethyl)phenyl]carbamothioylimino]-7-(4-isocyano-3-methylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 160823640 |
| Molecular Formula | C32H33F3N8O2S2 |
| Molecular Weight | 682.80 g/mol |
| Exact Mass | 682.21 |
| IUPAC Name | tert-butyl 4-[8-[[4-cyano-3-(trifluoromethyl)phenyl]carbamothioylimino]-7-(4-isocyano-3-methylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]piperazine-1-carboxylate |
| SMILES | [C-]#[N+]c1ccc(N2C(=S)N(N3CCN(C(=O)OC(C)(C)C)CC3)C3(CCC3)C2=NC(=S)Nc2ccc(C#N)c(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C32H33F3N8O2S2/c1-20-17-23(9-10-25(20)37-5)42-26(39-27(46)38-22-8-7-21(19-36)24(18-22)32(33,34)35)31(11-6-12-31)43(28(42)47)41-15-13-40(14-16-41)29(44)45-30(2,3)4/h7-10,17-18H,6,11-16H2,1-4H3,(H,38,46) |
| InChIKey | LOEXOLBFCVUJEG-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.80 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|