C29H34N6O2S — CID 88849862
tert-butyl 4-[4-[8-imino-7-(4-isocyano-3-methylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]piperazine-1-carboxylate (PubChem CID 88849862) has the molecular formula C29H34N6O2S and a molecular weight of 530.70 g/mol. Its IUPAC name is tert-butyl 4-[4-[8-imino-7-(4-isocyano-3-methylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[8-imino-7-(4-isocyano-3-methylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 88849862 |
| Molecular Formula | C29H34N6O2S |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | tert-butyl 4-[4-[8-imino-7-(4-isocyano-3-methylphenyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenyl]piperazine-1-carboxylate |
| SMILES | [H]/N=C1/N(c2ccc([N+]#[C-])c(C)c2)C(=S)N(c2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc2)C12CCC2 |
| InChI | InChI=1S/C29H34N6O2S/c1-20-19-23(11-12-24(20)31-5)34-25(30)29(13-6-14-29)35(26(34)38)22-9-7-21(8-10-22)32-15-17-33(18-16-32)27(36)37-28(2,3)4/h7-12,19,30H,6,13-18H2,1-4H3/b30-25+ |
| InChIKey | YIJXZDXZEGHTGK-QCWLDUFUSA-N |
| XLogP | 6.11 |
| TPSA | 67.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|