C22H19FN4O2S — CID 158812291
3,5-dideuterio-2-fluoro-4-[7-(4-isocyano-3-methylphenyl)-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]-N-methylbenzamide (PubChem CID 158812291) has the molecular formula C22H19FN4O2S and a molecular weight of 424.50 g/mol. Its IUPAC name is 3,5-dideuterio-2-fluoro-4-[7-(4-isocyano-3-methylphenyl)-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]-N-methylbenzamide.
| Compound Name | 3,5-dideuterio-2-fluoro-4-[7-(4-isocyano-3-methylphenyl)-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 158812291 |
| Molecular Formula | C22H19FN4O2S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 3,5-dideuterio-2-fluoro-4-[7-(4-isocyano-3-methylphenyl)-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]-N-methylbenzamide |
| SMILES | [2H]c1cc(C(=O)NC)c(F)c([2H])c1N1C(=S)N(c2ccc([N+]#[C-])c(C)c2)C(=O)C12CCC2 |
| InChI | InChI=1S/C22H19FN4O2S/c1-13-11-14(6-8-18(13)24-2)26-20(29)22(9-4-10-22)27(21(26)30)15-5-7-16(17(23)12-15)19(28)25-3/h5-8,11-12H,4,9-10H2,1,3H3,(H,25,28)/i5D,12D |
| InChIKey | YSQMBENERIGWBU-BXOMONPRSA-N |
| XLogP | 4.11 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|