C27H31FN4O2S — CID 158549831
1,1-dimethylcyclohexane;2-fluoro-4-[3-(4-isocyano-3-methylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]-N-methylbenzamide (PubChem CID 158549831) has the molecular formula C27H31FN4O2S and a molecular weight of 494.64 g/mol. Its IUPAC name is 1,1-dimethylcyclohexane;2-fluoro-4-[3-(4-isocyano-3-methylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]-N-methylbenzamide.
| Compound Name | 1,1-dimethylcyclohexane;2-fluoro-4-[3-(4-isocyano-3-methylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 158549831 |
| Molecular Formula | C27H31FN4O2S |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 1,1-dimethylcyclohexane;2-fluoro-4-[3-(4-isocyano-3-methylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]-N-methylbenzamide |
| SMILES | CC1(C)CCCCC1.[C-]#[N+]c1ccc(N2C(=O)CN(c3ccc(C(=O)NC)c(F)c3)C2=S)cc1C |
| InChI | InChI=1S/C19H15FN4O2S.C8H16/c1-11-8-13(5-7-16(11)21-2)24-17(25)10-23(19(24)27)12-4-6-14(15(20)9-12)18(26)22-3;1-8(2)6-4-3-5-7-8/h4-9H,10H2,1,3H3,(H,22,26);3-7H2,1-2H3 |
| InChIKey | HPOPVQSMHWQTDF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|