C28H31FN4O2S — CID 158329778
2-fluoro-4-[3-(4-isocyano-3-methylphenyl)-7,7,9,9-tetramethyl-4-oxo-2-sulfanylidene-1,3-diazaspiro[4.5]decan-1-yl]-N-methylbenzamide (PubChem CID 158329778) has the molecular formula C28H31FN4O2S and a molecular weight of 506.65 g/mol. Its IUPAC name is 2-fluoro-4-[3-(4-isocyano-3-methylphenyl)-7,7,9,9-tetramethyl-4-oxo-2-sulfanylidene-1,3-diazaspiro[4.5]decan-1-yl]-N-methylbenzamide.
| Compound Name | 2-fluoro-4-[3-(4-isocyano-3-methylphenyl)-7,7,9,9-tetramethyl-4-oxo-2-sulfanylidene-1,3-diazaspiro[4.5]decan-1-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 158329778 |
| Molecular Formula | C28H31FN4O2S |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 2-fluoro-4-[3-(4-isocyano-3-methylphenyl)-7,7,9,9-tetramethyl-4-oxo-2-sulfanylidene-1,3-diazaspiro[4.5]decan-1-yl]-N-methylbenzamide |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C3(CC(C)(C)CC(C)(C)C3)N(c3ccc(C(=O)NC)c(F)c3)C2=S)cc1C |
| InChI | InChI=1S/C28H31FN4O2S/c1-17-12-18(9-11-22(17)30-6)32-24(35)28(15-26(2,3)14-27(4,5)16-28)33(25(32)36)19-8-10-20(21(29)13-19)23(34)31-7/h8-13H,14-16H2,1-5,7H3,(H,31,34) |
| InChIKey | HGNVQUPEUCSPRF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|