C19H12F4N4O2S — CID 74222948
4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2-fluoro-N-methylbenzamide (PubChem CID 74222948) has the molecular formula C19H12F4N4O2S and a molecular weight of 436.39 g/mol. Its IUPAC name is 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2-fluoro-N-methylbenzamide.
| Compound Name | 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 74222948 |
| Molecular Formula | C19H12F4N4O2S |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2-fluoro-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(N2CC(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C2=S)cc1F |
| InChI | InChI=1S/C19H12F4N4O2S/c1-25-17(29)13-5-4-11(7-15(13)20)26-9-16(28)27(18(26)30)12-3-2-10(8-24)14(6-12)19(21,22)23/h2-7H,9H2,1H3,(H,25,29) |
| InChIKey | SLFRGHYRUGAWGO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|