C27H26F4N4O4S — CID 151336811
methyl 6-[[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2-fluorobenzoyl]amino]hexanoate (PubChem CID 151336811) has the molecular formula C27H26F4N4O4S and a molecular weight of 578.59 g/mol. Its IUPAC name is methyl 6-[[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2-fluorobenzoyl]amino]hexanoate.
| Compound Name | methyl 6-[[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2-fluorobenzoyl]amino]hexanoate |
|---|---|
| PubChem CID | 151336811 |
| Molecular Formula | C27H26F4N4O4S |
| Molecular Weight | 578.59 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | methyl 6-[[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2-fluorobenzoyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1ccc(N2C(=S)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C2(C)C)cc1F |
| InChI | InChI=1S/C27H26F4N4O4S/c1-26(2)24(38)34(17-9-8-16(15-32)20(13-17)27(29,30)31)25(40)35(26)18-10-11-19(21(28)14-18)23(37)33-12-6-4-5-7-22(36)39-3/h8-11,13-14H,4-7,12H2,1-3H3,(H,33,37) |
| InChIKey | OJPMEWITKAPMCS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|