C26H26F4N4O4S — CID 156696092
6-[[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylimidazolidin-1-yl]-2-fluorobenzoyl]amino]hexanoic acid (PubChem CID 156696092) has the molecular formula C26H26F4N4O4S and a molecular weight of 566.58 g/mol. Its IUPAC name is 6-[[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylimidazolidin-1-yl]-2-fluorobenzoyl]amino]hexanoic acid.
| Compound Name | 6-[[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylimidazolidin-1-yl]-2-fluorobenzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 156696092 |
| Molecular Formula | C26H26F4N4O4S |
| Molecular Weight | 566.58 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | 6-[[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylimidazolidin-1-yl]-2-fluorobenzoyl]amino]hexanoic acid |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(S)N1c1ccc(C(=O)NCCCCCC(=O)O)c(F)c1 |
| InChI | InChI=1S/C26H26F4N4O4S/c1-25(2)23(38)33(16-8-7-15(14-31)19(12-16)26(28,29)30)24(39)34(25)17-9-10-18(20(27)13-17)22(37)32-11-5-3-4-6-21(35)36/h7-10,12-13,24,39H,3-6,11H2,1-2H3,(H,32,37)(H,35,36) |
| InChIKey | SLTLICHQLABYMU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|