C26H31Cl2F3N4O2S — CID 162351145
4-[3-(3-ethyl-4-piperidin-4-yloxyphenyl)-4,4-dimethyl-5-oxo-2-sulfanylimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile;dihydrochloride (PubChem CID 162351145) has the molecular formula C26H31Cl2F3N4O2S and a molecular weight of 591.53 g/mol. Its IUPAC name is 4-[3-(3-ethyl-4-piperidin-4-yloxyphenyl)-4,4-dimethyl-5-oxo-2-sulfanylimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile;dihydrochloride.
| Compound Name | 4-[3-(3-ethyl-4-piperidin-4-yloxyphenyl)-4,4-dimethyl-5-oxo-2-sulfanylimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 162351145 |
| Molecular Formula | C26H31Cl2F3N4O2S |
| Molecular Weight | 591.53 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | 4-[3-(3-ethyl-4-piperidin-4-yloxyphenyl)-4,4-dimethyl-5-oxo-2-sulfanylimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile;dihydrochloride |
| SMILES | CCc1cc(N2C(S)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C2(C)C)ccc1OC1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C26H29F3N4O2S.2ClH/c1-4-16-13-19(7-8-22(16)35-20-9-11-31-12-10-20)33-24(36)32(23(34)25(33,2)3)18-6-5-17(15-30)21(14-18)26(27,28)29;;/h5-8,13-14,20,24,31,36H,4,9-12H2,1-3H3;2*1H |
| InChIKey | DZEZUMLPYVFNEL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.53 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|