C21H15F4N3O3S — CID 168865471
4-[7-[4-cyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanyl-5,7-diazaspiro[3.4]octan-5-yl]-2-fluorobenzoic acid (PubChem CID 168865471) has the molecular formula C21H15F4N3O3S and a molecular weight of 465.43 g/mol. Its IUPAC name is 4-[7-[4-cyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanyl-5,7-diazaspiro[3.4]octan-5-yl]-2-fluorobenzoic acid.
| Compound Name | 4-[7-[4-cyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanyl-5,7-diazaspiro[3.4]octan-5-yl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 168865471 |
| Molecular Formula | C21H15F4N3O3S |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 4-[7-[4-cyano-3-(trifluoromethyl)phenyl]-8-oxo-6-sulfanyl-5,7-diazaspiro[3.4]octan-5-yl]-2-fluorobenzoic acid |
| SMILES | N#Cc1ccc(N2C(=O)C3(CCC3)N(c3ccc(C(=O)O)c(F)c3)C2S)cc1C(F)(F)F |
| InChI | InChI=1S/C21H15F4N3O3S/c22-16-9-13(4-5-14(16)17(29)30)28-19(32)27(18(31)20(28)6-1-7-20)12-3-2-11(10-26)15(8-12)21(23,24)25/h2-5,8-9,19,32H,1,6-7H2,(H,29,30) |
| InChIKey | MYZNZBRWFNLMOE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|