C21H18FN5O2S — CID 141232792
4-[3-(3,4-dicyanophenyl)-5,5-dimethyl-4-oxo-2-sulfanylimidazolidin-1-yl]-2-fluoro-N-methylbenzamide (PubChem CID 141232792) has the molecular formula C21H18FN5O2S and a molecular weight of 423.47 g/mol. Its IUPAC name is 4-[3-(3,4-dicyanophenyl)-5,5-dimethyl-4-oxo-2-sulfanylimidazolidin-1-yl]-2-fluoro-N-methylbenzamide.
| Compound Name | 4-[3-(3,4-dicyanophenyl)-5,5-dimethyl-4-oxo-2-sulfanylimidazolidin-1-yl]-2-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 141232792 |
| Molecular Formula | C21H18FN5O2S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 4-[3-(3,4-dicyanophenyl)-5,5-dimethyl-4-oxo-2-sulfanylimidazolidin-1-yl]-2-fluoro-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(N2C(S)N(c3ccc(C#N)c(C#N)c3)C(=O)C2(C)C)cc1F |
| InChI | InChI=1S/C21H18FN5O2S/c1-21(2)19(29)26(14-5-4-12(10-23)13(8-14)11-24)20(30)27(21)15-6-7-16(17(22)9-15)18(28)25-3/h4-9,20,30H,1-3H3,(H,25,28) |
| InChIKey | SUSYORGRKSGKBN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 100.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|