C21H17F4N5O4S — CID 174982506
1-[4-cyano-3-(trifluoromethyl)phenyl]-3-[3-fluoro-4-(methylcarbamoyl)phenyl]-4,4-dimethyl-5-oxo-2-sulfinoiminoimidazolidine (PubChem CID 174982506) has the molecular formula C21H17F4N5O4S and a molecular weight of 511.46 g/mol. Its IUPAC name is 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-[3-fluoro-4-(methylcarbamoyl)phenyl]-4,4-dimethyl-5-oxo-2-sulfinoiminoimidazolidine.
| Compound Name | 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-[3-fluoro-4-(methylcarbamoyl)phenyl]-4,4-dimethyl-5-oxo-2-sulfinoiminoimidazolidine |
|---|---|
| PubChem CID | 174982506 |
| Molecular Formula | C21H17F4N5O4S |
| Molecular Weight | 511.46 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-[3-fluoro-4-(methylcarbamoyl)phenyl]-4,4-dimethyl-5-oxo-2-sulfinoiminoimidazolidine |
| SMILES | CNC(=O)c1ccc(N2C(=NS(=O)O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C2(C)C)cc1F |
| InChI | InChI=1S/C21H17F4N5O4S/c1-20(2)18(32)29(12-5-4-11(10-26)15(8-12)21(23,24)25)19(28-35(33)34)30(20)13-6-7-14(16(22)9-13)17(31)27-3/h4-9H,1-3H3,(H,27,31)(H,33,34) |
| InChIKey | BURCWRDTYYFZNN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 126.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|