C23H19F4N3O4S — CID 146478878
2-methoxyethyl 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2-fluorobenzoate (PubChem CID 146478878) has the molecular formula C23H19F4N3O4S and a molecular weight of 509.48 g/mol. Its IUPAC name is 2-methoxyethyl 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2-fluorobenzoate.
| Compound Name | 2-methoxyethyl 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 146478878 |
| Molecular Formula | C23H19F4N3O4S |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 2-methoxyethyl 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-2-fluorobenzoate |
| SMILES | COCCOC(=O)c1ccc(N2C(=S)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C2(C)C)cc1F |
| InChI | InChI=1S/C23H19F4N3O4S/c1-22(2)20(32)29(14-5-4-13(12-28)17(10-14)23(25,26)27)21(35)30(22)15-6-7-16(18(24)11-15)19(31)34-9-8-33-3/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | NICFJTOUUPIPER-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|