C24H20F4N4O2S — CID 123474590
11-[4-cyano-3-(trifluoromethyl)phenyl]-4-fluoro-N,8-dimethyl-10-oxo-12-sulfanylidene-1,11-diazatricyclo[6.4.3.02,7]pentadeca-2(7),3,5-triene-5-carboxamide (PubChem CID 123474590) has the molecular formula C24H20F4N4O2S and a molecular weight of 504.51 g/mol. Its IUPAC name is 11-[4-cyano-3-(trifluoromethyl)phenyl]-4-fluoro-N,8-dimethyl-10-oxo-12-sulfanylidene-1,11-diazatricyclo[6.4.3.02,7]pentadeca-2(7),3,5-triene-5-carboxamide.
| Compound Name | 11-[4-cyano-3-(trifluoromethyl)phenyl]-4-fluoro-N,8-dimethyl-10-oxo-12-sulfanylidene-1,11-diazatricyclo[6.4.3.02,7]pentadeca-2(7),3,5-triene-5-carboxamide |
|---|---|
| PubChem CID | 123474590 |
| Molecular Formula | C24H20F4N4O2S |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 11-[4-cyano-3-(trifluoromethyl)phenyl]-4-fluoro-N,8-dimethyl-10-oxo-12-sulfanylidene-1,11-diazatricyclo[6.4.3.02,7]pentadeca-2(7),3,5-triene-5-carboxamide |
| SMILES | CNC(=O)c1cc2c(cc1F)N1CCCC2(C)CC(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C1=S |
| InChI | InChI=1S/C24H20F4N4O2S/c1-23-6-3-7-31(19-10-18(25)15(9-17(19)23)21(34)30-2)22(35)32(20(33)11-23)14-5-4-13(12-29)16(8-14)24(26,27)28/h4-5,8-10H,3,6-7,11H2,1-2H3,(H,30,34) |
| InChIKey | DYGPOJYOMRXTAY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|