C29H33F3N6O2S — CID 89276670
tert-butyl 4-[4-[[4-cyano-3-(trifluoromethyl)phenyl]carbamothioyl-(1-methanimidoylcyclobutyl)amino]phenyl]piperazine-1-carboxylate (PubChem CID 89276670) has the molecular formula C29H33F3N6O2S and a molecular weight of 586.68 g/mol. Its IUPAC name is tert-butyl 4-[4-[[4-cyano-3-(trifluoromethyl)phenyl]carbamothioyl-(1-methanimidoylcyclobutyl)amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[4-cyano-3-(trifluoromethyl)phenyl]carbamothioyl-(1-methanimidoylcyclobutyl)amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 89276670 |
| Molecular Formula | C29H33F3N6O2S |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | tert-butyl 4-[4-[[4-cyano-3-(trifluoromethyl)phenyl]carbamothioyl-(1-methanimidoylcyclobutyl)amino]phenyl]piperazine-1-carboxylate |
| SMILES | [H]/N=C/C1(N(C(=S)Nc2ccc(C#N)c(C(F)(F)F)c2)c2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc2)CCC1 |
| InChI | InChI=1S/C29H33F3N6O2S/c1-27(2,3)40-26(39)37-15-13-36(14-16-37)22-7-9-23(10-8-22)38(28(19-34)11-4-12-28)25(41)35-21-6-5-20(18-33)24(17-21)29(30,31)32/h5-10,17,19,34H,4,11-16H2,1-3H3,(H,35,41)/b34-19+ |
| InChIKey | URPDLSOXNDVMBT-ALQBTCKLSA-N |
| XLogP | 6.41 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|