C19H24F3N3O2 — CID 163399584
tert-butyl N-[4-[4-cyano-3-(trifluoromethyl)anilino]cyclohexyl]carbamate (PubChem CID 163399584) has the molecular formula C19H24F3N3O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is tert-butyl N-[4-[4-cyano-3-(trifluoromethyl)anilino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-cyano-3-(trifluoromethyl)anilino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 163399584 |
| Molecular Formula | C19H24F3N3O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | tert-butyl N-[4-[4-cyano-3-(trifluoromethyl)anilino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(Nc2ccc(C#N)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H24F3N3O2/c1-18(2,3)27-17(26)25-14-8-6-13(7-9-14)24-15-5-4-12(11-23)16(10-15)19(20,21)22/h4-5,10,13-14,24H,6-9H2,1-3H3,(H,25,26) |
| InChIKey | TZIBJAJRDVNLST-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |