C18H25ClN4O3 — CID 86655104
tert-butyl N-[4-[(3-chloro-5-cyano-6-methoxy-2-pyridinyl)amino]cyclohexyl]carbamate (PubChem CID 86655104) has the molecular formula C18H25ClN4O3 and a molecular weight of 380.88 g/mol. Its IUPAC name is tert-butyl N-[4-[(3-chloro-5-cyano-6-methoxy-2-pyridinyl)amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(3-chloro-5-cyano-6-methoxy-2-pyridinyl)amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 86655104 |
| Molecular Formula | C18H25ClN4O3 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | tert-butyl N-[4-[(3-chloro-5-cyano-6-methoxy-2-pyridinyl)amino]cyclohexyl]carbamate |
| SMILES | COc1nc(NC2CCC(NC(=O)OC(C)(C)C)CC2)c(Cl)cc1C#N |
| InChI | InChI=1S/C18H25ClN4O3/c1-18(2,3)26-17(24)22-13-7-5-12(6-8-13)21-15-14(19)9-11(10-20)16(23-15)25-4/h9,12-13H,5-8H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | AGRWWOLFELDIHG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |