C17H25ClN6O4S — CID 59591661
tert-butyl N-[4-[(6-chloro-3-methylperoxysulfanyl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)amino]cyclohexyl]carbamate (PubChem CID 59591661) has the molecular formula C17H25ClN6O4S and a molecular weight of 444.95 g/mol. Its IUPAC name is tert-butyl N-[4-[(6-chloro-3-methylperoxysulfanyl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(6-chloro-3-methylperoxysulfanyl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 59591661 |
| Molecular Formula | C17H25ClN6O4S |
| Molecular Weight | 444.95 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | tert-butyl N-[4-[(6-chloro-3-methylperoxysulfanyl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)amino]cyclohexyl]carbamate |
| SMILES | COOSc1n[nH]c2nc(Cl)nc(NC3CCC(NC(=O)OC(C)(C)C)CC3)c12 |
| InChI | InChI=1S/C17H25ClN6O4S/c1-17(2,3)27-16(25)20-10-7-5-9(6-8-10)19-12-11-13(22-15(18)21-12)23-24-14(11)29-28-26-4/h9-10H,5-8H2,1-4H3,(H,20,25)(H2,19,21,22,23,24) |
| InChIKey | CDDGOKFRIOGUSF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 123.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.95 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|