C13H22N4O2S — CID 107648652
tert-butyl N-[4-(1,3,4-thiadiazol-2-ylamino)cyclohexyl]carbamate (PubChem CID 107648652) has the molecular formula C13H22N4O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is tert-butyl N-[4-(1,3,4-thiadiazol-2-ylamino)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-(1,3,4-thiadiazol-2-ylamino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 107648652 |
| Molecular Formula | C13H22N4O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | tert-butyl N-[4-(1,3,4-thiadiazol-2-ylamino)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(Nc2nncs2)CC1 |
| InChI | InChI=1S/C13H22N4O2S/c1-13(2,3)19-12(18)16-10-6-4-9(5-7-10)15-11-17-14-8-20-11/h8-10H,4-7H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | NSPQHGKELIZDQL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |