C14H24N4O2S — CID 103923191
tert-butyl N-[4-(thiadiazol-4-ylmethylamino)cyclohexyl]carbamate (PubChem CID 103923191) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is tert-butyl N-[4-(thiadiazol-4-ylmethylamino)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-(thiadiazol-4-ylmethylamino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 103923191 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | tert-butyl N-[4-(thiadiazol-4-ylmethylamino)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(NCc2csnn2)CC1 |
| InChI | InChI=1S/C14H24N4O2S/c1-14(2,3)20-13(19)16-11-6-4-10(5-7-11)15-8-12-9-21-18-17-12/h9-11,15H,4-8H2,1-3H3,(H,16,19) |
| InChIKey | UXGGLTQKQVVLSH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |