C17H26BrN3O2 — CID 104856976
tert-butyl N-[4-[(5-bromo-3-pyridinyl)methylamino]cyclohexyl]carbamate (PubChem CID 104856976) has the molecular formula C17H26BrN3O2 and a molecular weight of 384.32 g/mol. Its IUPAC name is tert-butyl N-[4-[(5-bromo-3-pyridinyl)methylamino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(5-bromo-3-pyridinyl)methylamino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 104856976 |
| Molecular Formula | C17H26BrN3O2 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | tert-butyl N-[4-[(5-bromo-3-pyridinyl)methylamino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(NCc2cncc(Br)c2)CC1 |
| InChI | InChI=1S/C17H26BrN3O2/c1-17(2,3)23-16(22)21-15-6-4-14(5-7-15)20-10-12-8-13(18)11-19-9-12/h8-9,11,14-15,20H,4-7,10H2,1-3H3,(H,21,22) |
| InChIKey | IQOMESOWGBBUJX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |