C16H28N4O2S — CID 103922943
tert-butyl N-[2-cyclohexyl-2-(thiadiazol-4-ylmethylamino)ethyl]carbamate (PubChem CID 103922943) has the molecular formula C16H28N4O2S and a molecular weight of 340.49 g/mol. Its IUPAC name is tert-butyl N-[2-cyclohexyl-2-(thiadiazol-4-ylmethylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-cyclohexyl-2-(thiadiazol-4-ylmethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 103922943 |
| Molecular Formula | C16H28N4O2S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | tert-butyl N-[2-cyclohexyl-2-(thiadiazol-4-ylmethylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(NCc1csnn1)C1CCCCC1 |
| InChI | InChI=1S/C16H28N4O2S/c1-16(2,3)22-15(21)18-10-14(12-7-5-4-6-8-12)17-9-13-11-23-20-19-13/h11-12,14,17H,4-10H2,1-3H3,(H,18,21) |
| InChIKey | QPVIEQHRYRNREV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |