C17H28N4O2 — CID 106834314
tert-butyl N-[2-cyclopentyl-2-(pyrimidin-5-ylmethylamino)ethyl]carbamate (PubChem CID 106834314) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is tert-butyl N-[2-cyclopentyl-2-(pyrimidin-5-ylmethylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-cyclopentyl-2-(pyrimidin-5-ylmethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 106834314 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | tert-butyl N-[2-cyclopentyl-2-(pyrimidin-5-ylmethylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(NCc1cncnc1)C1CCCC1 |
| InChI | InChI=1S/C17H28N4O2/c1-17(2,3)23-16(22)21-11-15(14-6-4-5-7-14)20-10-13-8-18-12-19-9-13/h8-9,12,14-15,20H,4-7,10-11H2,1-3H3,(H,21,22) |
| InChIKey | KMMDOEHKAPFKKH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |