C16H26N4O2 — CID 107094759
tert-butyl N-[2-cyclopropyl-2-[(1-ethenylpyrazol-4-yl)methylamino]ethyl]carbamate (PubChem CID 107094759) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is tert-butyl N-[2-cyclopropyl-2-[(1-ethenylpyrazol-4-yl)methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-cyclopropyl-2-[(1-ethenylpyrazol-4-yl)methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 107094759 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | tert-butyl N-[2-cyclopropyl-2-[(1-ethenylpyrazol-4-yl)methylamino]ethyl]carbamate |
| SMILES | C=Cn1cc(CNC(CNC(=O)OC(C)(C)C)C2CC2)cn1 |
| InChI | InChI=1S/C16H26N4O2/c1-5-20-11-12(9-19-20)8-17-14(13-6-7-13)10-18-15(21)22-16(2,3)4/h5,9,11,13-14,17H,1,6-8,10H2,2-4H3,(H,18,21) |
| InChIKey | FVYOEYVWHSELSR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |