C17H28N4O2 — CID 107094696
tert-butyl N-cyclopropyl-N-[3-[(1-ethenylpyrazol-4-yl)methylamino]propyl]carbamate (PubChem CID 107094696) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[3-[(1-ethenylpyrazol-4-yl)methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-cyclopropyl-N-[3-[(1-ethenylpyrazol-4-yl)methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 107094696 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[3-[(1-ethenylpyrazol-4-yl)methylamino]propyl]carbamate |
| SMILES | C=Cn1cc(CNCCCN(C(=O)OC(C)(C)C)C2CC2)cn1 |
| InChI | InChI=1S/C17H28N4O2/c1-5-20-13-14(12-19-20)11-18-9-6-10-21(15-7-8-15)16(22)23-17(2,3)4/h5,12-13,15,18H,1,6-11H2,2-4H3 |
| InChIKey | CBQOBBJFNDBZRP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|