C18H32N4O2 — CID 56827321
tert-butyl 4-[(1-tert-butylpyrazol-4-yl)methylamino]piperidine-1-carboxylate (PubChem CID 56827321) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is tert-butyl 4-[(1-tert-butylpyrazol-4-yl)methylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1-tert-butylpyrazol-4-yl)methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 56827321 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | tert-butyl 4-[(1-tert-butylpyrazol-4-yl)methylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NCc2cnn(C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C18H32N4O2/c1-17(2,3)22-13-14(12-20-22)11-19-15-7-9-21(10-8-15)16(23)24-18(4,5)6/h12-13,15,19H,7-11H2,1-6H3 |
| InChIKey | PHAZZIFIZIIQCR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |