C18H32N4O2 — CID 75473183
tert-butyl 3-[1-[(1-propylpyrazol-4-yl)amino]ethyl]piperidine-1-carboxylate (PubChem CID 75473183) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is tert-butyl 3-[1-[(1-propylpyrazol-4-yl)amino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-[(1-propylpyrazol-4-yl)amino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 75473183 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | tert-butyl 3-[1-[(1-propylpyrazol-4-yl)amino]ethyl]piperidine-1-carboxylate |
| SMILES | CCCn1cc(NC(C)C2CCCN(C(=O)OC(C)(C)C)C2)cn1 |
| InChI | InChI=1S/C18H32N4O2/c1-6-9-22-13-16(11-19-22)20-14(2)15-8-7-10-21(12-15)17(23)24-18(3,4)5/h11,13-15,20H,6-10,12H2,1-5H3 |
| InChIKey | AXDSSHJBRSSLCS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |