C15H21N3O2 — CID 122241582
tert-butyl 4-(4-ethynylpyrazol-1-yl)piperidine-1-carboxylate (PubChem CID 122241582) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is tert-butyl 4-(4-ethynylpyrazol-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-ethynylpyrazol-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 122241582 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | tert-butyl 4-(4-ethynylpyrazol-1-yl)piperidine-1-carboxylate |
| SMILES | C#Cc1cnn(C2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C15H21N3O2/c1-5-12-10-16-18(11-12)13-6-8-17(9-7-13)14(19)20-15(2,3)4/h1,10-11,13H,6-9H2,2-4H3 |
| InChIKey | PMUVUSISNQCUDP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|