C23H26ClFN4O3 — CID 169103081
tert-butyl N-[1-[6-chloro-4-cyano-5-(3-fluoro-4-methoxyphenyl)-2-pyridinyl]piperidin-4-yl]carbamate (PubChem CID 169103081) has the molecular formula C23H26ClFN4O3 and a molecular weight of 460.94 g/mol. Its IUPAC name is tert-butyl N-[1-[6-chloro-4-cyano-5-(3-fluoro-4-methoxyphenyl)-2-pyridinyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[6-chloro-4-cyano-5-(3-fluoro-4-methoxyphenyl)-2-pyridinyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 169103081 |
| Molecular Formula | C23H26ClFN4O3 |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | tert-butyl N-[1-[6-chloro-4-cyano-5-(3-fluoro-4-methoxyphenyl)-2-pyridinyl]piperidin-4-yl]carbamate |
| SMILES | COc1ccc(-c2c(C#N)cc(N3CCC(NC(=O)OC(C)(C)C)CC3)nc2Cl)cc1F |
| InChI | InChI=1S/C23H26ClFN4O3/c1-23(2,3)32-22(30)27-16-7-9-29(10-8-16)19-12-15(13-26)20(21(24)28-19)14-5-6-18(31-4)17(25)11-14/h5-6,11-12,16H,7-10H2,1-4H3,(H,27,30) |
| InChIKey | OKPOGIJIVGFCQE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|