C23H24FN5O2 — CID 171743594
tert-butyl N-[1-[4-cyano-6-(3-fluoro-4-isocyanophenyl)-2-pyridinyl]piperidin-4-yl]carbamate (PubChem CID 171743594) has the molecular formula C23H24FN5O2 and a molecular weight of 421.48 g/mol. Its IUPAC name is tert-butyl N-[1-[4-cyano-6-(3-fluoro-4-isocyanophenyl)-2-pyridinyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-cyano-6-(3-fluoro-4-isocyanophenyl)-2-pyridinyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 171743594 |
| Molecular Formula | C23H24FN5O2 |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | tert-butyl N-[1-[4-cyano-6-(3-fluoro-4-isocyanophenyl)-2-pyridinyl]piperidin-4-yl]carbamate |
| SMILES | [C-]#[N+]c1ccc(-c2cc(C#N)cc(N3CCC(NC(=O)OC(C)(C)C)CC3)n2)cc1F |
| InChI | InChI=1S/C23H24FN5O2/c1-23(2,3)31-22(30)27-17-7-9-29(10-8-17)21-12-15(14-25)11-20(28-21)16-5-6-19(26-4)18(24)13-16/h5-6,11-13,17H,7-10H2,1-3H3,(H,27,30) |
| InChIKey | DVGPVXXVAOBNAW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|