C24H25FN4O2 — CID 170357435
tert-butyl N-[1-[2-cyano-3-(4-cyano-3-fluorophenyl)phenyl]piperidin-4-yl]carbamate (PubChem CID 170357435) has the molecular formula C24H25FN4O2 and a molecular weight of 420.49 g/mol. Its IUPAC name is tert-butyl N-[1-[2-cyano-3-(4-cyano-3-fluorophenyl)phenyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-cyano-3-(4-cyano-3-fluorophenyl)phenyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 170357435 |
| Molecular Formula | C24H25FN4O2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | tert-butyl N-[1-[2-cyano-3-(4-cyano-3-fluorophenyl)phenyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2cccc(-c3ccc(C#N)c(F)c3)c2C#N)CC1 |
| InChI | InChI=1S/C24H25FN4O2/c1-24(2,3)31-23(30)28-18-9-11-29(12-10-18)22-6-4-5-19(20(22)15-27)16-7-8-17(14-26)21(25)13-16/h4-8,13,18H,9-12H2,1-3H3,(H,28,30) |
| InChIKey | BTIJKKMJQJVCJR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |