C18H24FN3O2S — CID 59656675
tert-butyl N-[1-(4-cyano-3-fluoro-5-methylsulfanylphenyl)piperidin-4-yl]carbamate (PubChem CID 59656675) has the molecular formula C18H24FN3O2S and a molecular weight of 365.47 g/mol. Its IUPAC name is tert-butyl N-[1-(4-cyano-3-fluoro-5-methylsulfanylphenyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-cyano-3-fluoro-5-methylsulfanylphenyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 59656675 |
| Molecular Formula | C18H24FN3O2S |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | tert-butyl N-[1-(4-cyano-3-fluoro-5-methylsulfanylphenyl)piperidin-4-yl]carbamate |
| SMILES | CSc1cc(N2CCC(NC(=O)OC(C)(C)C)CC2)cc(F)c1C#N |
| InChI | InChI=1S/C18H24FN3O2S/c1-18(2,3)24-17(23)21-12-5-7-22(8-6-12)13-9-15(19)14(11-20)16(10-13)25-4/h9-10,12H,5-8H2,1-4H3,(H,21,23) |
| InChIKey | METMGKAWAQPATA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |