C16H22N4O2 — CID 66756810
tert-butyl N-[1-(5-cyano-3-pyridinyl)piperidin-4-yl]carbamate (PubChem CID 66756810) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is tert-butyl N-[1-(5-cyano-3-pyridinyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(5-cyano-3-pyridinyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 66756810 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | tert-butyl N-[1-(5-cyano-3-pyridinyl)piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2cncc(C#N)c2)CC1 |
| InChI | InChI=1S/C16H22N4O2/c1-16(2,3)22-15(21)19-13-4-6-20(7-5-13)14-8-12(9-17)10-18-11-14/h8,10-11,13H,4-7H2,1-3H3,(H,19,21) |
| InChIKey | KIWSGLFOKBCUEZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |