C22H24N4O3 — CID 139392692
tert-butyl N-[1-[3-(3-cyanophenyl)-5-formyl-4-pyridinyl]pyrrolidin-3-yl]carbamate (PubChem CID 139392692) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(3-cyanophenyl)-5-formyl-4-pyridinyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-(3-cyanophenyl)-5-formyl-4-pyridinyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 139392692 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | tert-butyl N-[1-[3-(3-cyanophenyl)-5-formyl-4-pyridinyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2c(C=O)cncc2-c2cccc(C#N)c2)C1 |
| InChI | InChI=1S/C22H24N4O3/c1-22(2,3)29-21(28)25-18-7-8-26(13-18)20-17(14-27)11-24-12-19(20)16-6-4-5-15(9-16)10-23/h4-6,9,11-12,14,18H,7-8,13H2,1-3H3,(H,25,28) |
| InChIKey | RJWVFIGDIWHGHJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|