C14H19BrClN3O2 — CID 139392588
tert-butyl N-[1-(3-bromo-5-chloro-4-pyridinyl)pyrrolidin-3-yl]carbamate (PubChem CID 139392588) has the molecular formula C14H19BrClN3O2 and a molecular weight of 376.68 g/mol. Its IUPAC name is tert-butyl N-[1-(3-bromo-5-chloro-4-pyridinyl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3-bromo-5-chloro-4-pyridinyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 139392588 |
| Molecular Formula | C14H19BrClN3O2 |
| Molecular Weight | 376.68 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | tert-butyl N-[1-(3-bromo-5-chloro-4-pyridinyl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2c(Cl)cncc2Br)C1 |
| InChI | InChI=1S/C14H19BrClN3O2/c1-14(2,3)21-13(20)18-9-4-5-19(8-9)12-10(15)6-17-7-11(12)16/h6-7,9H,4-5,8H2,1-3H3,(H,18,20) |
| InChIKey | LDNVNABPWBECPP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.68 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |