C13H19ClN4O3 — CID 133380878
tert-butyl N-[(3S)-1-(5-chloro-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl]carbamate (PubChem CID 133380878) has the molecular formula C13H19ClN4O3 and a molecular weight of 314.77 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-(5-chloro-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-(5-chloro-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 133380878 |
| Molecular Formula | C13H19ClN4O3 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | tert-butyl N-[(3S)-1-(5-chloro-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCN(c2cn[nH]c(=O)c2Cl)C1 |
| InChI | InChI=1S/C13H19ClN4O3/c1-13(2,3)21-12(20)16-8-4-5-18(7-8)9-6-15-17-11(19)10(9)14/h6,8H,4-5,7H2,1-3H3,(H,16,20)(H,17,19)/t8-/m0/s1 |
| InChIKey | VVSAUJKTOIFUSB-QMMMGPOBSA-N |
| XLogP | 1.53 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |