C44H51FN4O7 — CID 177282587
methyl 7-[4-[2-(3-fluoro-4-isocyanophenyl)-4-methoxy-6-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-3-pyridinyl]-2-phenylmethoxyphenoxy]heptanoate (PubChem CID 177282587) has the molecular formula C44H51FN4O7 and a molecular weight of 766.91 g/mol. Its IUPAC name is methyl 7-[4-[2-(3-fluoro-4-isocyanophenyl)-4-methoxy-6-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-3-pyridinyl]-2-phenylmethoxyphenoxy]heptanoate.
| Compound Name | methyl 7-[4-[2-(3-fluoro-4-isocyanophenyl)-4-methoxy-6-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-3-pyridinyl]-2-phenylmethoxyphenoxy]heptanoate |
|---|---|
| PubChem CID | 177282587 |
| Molecular Formula | C44H51FN4O7 |
| Molecular Weight | 766.91 g/mol |
| Exact Mass | 766.37 |
| IUPAC Name | methyl 7-[4-[2-(3-fluoro-4-isocyanophenyl)-4-methoxy-6-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-3-pyridinyl]-2-phenylmethoxyphenoxy]heptanoate |
| SMILES | [C-]#[N+]c1ccc(-c2nc(N3CCC(NC(=O)OC(C)(C)C)CC3)cc(OC)c2-c2ccc(OCCCCCCC(=O)OC)c(OCc3ccccc3)c2)cc1F |
| InChI | InChI=1S/C44H51FN4O7/c1-44(2,3)56-43(51)47-33-21-23-49(24-22-33)39-28-38(52-5)41(42(48-39)32-17-19-35(46-4)34(45)26-32)31-18-20-36(54-25-13-8-7-12-16-40(50)53-6)37(27-31)55-29-30-14-10-9-11-15-30/h9-11,14-15,17-20,26-28,33H,7-8,12-13,16,21-25,29H2,1-3,5-6H3,(H,47,51) |
| InChIKey | JTEGLTGZKCCSQN-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.91 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|