C26H26F3N3O3 — CID 55708637
3-methoxy-4-phenylmethoxy-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzamide (PubChem CID 55708637) has the molecular formula C26H26F3N3O3 and a molecular weight of 485.51 g/mol. Its IUPAC name is 3-methoxy-4-phenylmethoxy-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzamide.
| Compound Name | 3-methoxy-4-phenylmethoxy-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 55708637 |
| Molecular Formula | C26H26F3N3O3 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 3-methoxy-4-phenylmethoxy-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzamide |
| SMILES | COc1cc(C(=O)NC2CCN(c3ccc(C(F)(F)F)cn3)CC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H26F3N3O3/c1-34-23-15-19(7-9-22(23)35-17-18-5-3-2-4-6-18)25(33)31-21-11-13-32(14-12-21)24-10-8-20(16-30-24)26(27,28)29/h2-10,15-16,21H,11-14,17H2,1H3,(H,31,33) |
| InChIKey | KRLYNOKZDXTDDJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |