C23H34F3N3O2 — CID 171775749
tert-butyl N-[4-[3-[4-(trifluoromethyl)piperidin-1-yl]anilino]cyclohexyl]carbamate (PubChem CID 171775749) has the molecular formula C23H34F3N3O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is tert-butyl N-[4-[3-[4-(trifluoromethyl)piperidin-1-yl]anilino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-[4-(trifluoromethyl)piperidin-1-yl]anilino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 171775749 |
| Molecular Formula | C23H34F3N3O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | tert-butyl N-[4-[3-[4-(trifluoromethyl)piperidin-1-yl]anilino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(Nc2cccc(N3CCC(C(F)(F)F)CC3)c2)CC1 |
| InChI | InChI=1S/C23H34F3N3O2/c1-22(2,3)31-21(30)28-18-9-7-17(8-10-18)27-19-5-4-6-20(15-19)29-13-11-16(12-14-29)23(24,25)26/h4-6,15-18,27H,7-14H2,1-3H3,(H,28,30) |
| InChIKey | NWQRUJCEODEKGN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |