C23H31N3O3 — CID 118954527
tert-butyl N-[1-[3-(4-hydroxy-N-methylanilino)phenyl]piperidin-4-yl]carbamate (PubChem CID 118954527) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(4-hydroxy-N-methylanilino)phenyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-(4-hydroxy-N-methylanilino)phenyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 118954527 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | tert-butyl N-[1-[3-(4-hydroxy-N-methylanilino)phenyl]piperidin-4-yl]carbamate |
| SMILES | CN(c1ccc(O)cc1)c1cccc(N2CCC(NC(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C23H31N3O3/c1-23(2,3)29-22(28)24-17-12-14-26(15-13-17)20-7-5-6-19(16-20)25(4)18-8-10-21(27)11-9-18/h5-11,16-17,27H,12-15H2,1-4H3,(H,24,28) |
| InChIKey | KHFSQEKUNCFWGM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |